ethyl 1-hydroxy-2-methyl-6-nitroindole-3-carboxylate structure
|
Common Name | ethyl 1-hydroxy-2-methyl-6-nitroindole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 652969-90-9 | Molecular Weight | 264.23400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 1-hydroxy-2-methyl-6-nitroindole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N2O5 |
|---|---|
| Molecular Weight | 264.23400 |
| Exact Mass | 264.07500 |
| PSA | 97.28000 |
| LogP | 2.79510 |
| InChIKey | YVXLJCKPPBYVCA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)n(O)c2cc([N+](=O)[O-])ccc12 |
|
~58%
ethyl 1-hydroxy... CAS#:652969-90-9 |
| Literature: Camara, Hadietou Diadie; Attar, Khalid; Benchidmi, Mohamed; Essassi, El Mokhtar; Garriques, Bernard Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 3 p. 660 - 666 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-ethoxycarbonyl-1-hydroxy-2-methyl-6-nitroindole |
| 1H-Indole-3-carboxylic acid,1-hydroxy-2-methyl-6-nitro-,ethyl ester |