Benzene,pentafluoro[(trifluoroethenyl)oxy]- structure
|
Common Name | Benzene,pentafluoro[(trifluoroethenyl)oxy]- | ||
|---|---|---|---|---|
| CAS Number | 653-26-9 | Molecular Weight | 264.07200 | |
| Density | 1.644g/cm3 | Boiling Point | 122.5ºC at 760 mmHg | |
| Molecular Formula | C8F8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 33.6ºC | |
| Name | 1,2,3,4,5-Pentafluoro-6-[(trifluorovinyl)oxy]benzene |
|---|
| Density | 1.644g/cm3 |
|---|---|
| Boiling Point | 122.5ºC at 760 mmHg |
| Molecular Formula | C8F8O |
| Molecular Weight | 264.07200 |
| Flash Point | 33.6ºC |
| Exact Mass | 263.98200 |
| PSA | 9.23000 |
| LogP | 3.79600 |
| Index of Refraction | 1.386 |
| InChIKey | VXDMAOXNTAQJSJ-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)Oc1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |