2,5-Cyclohexadiene-1,4-dione,2,5-difluoro-3,6-dimethoxy
2,5-Cyclohexadiene-1,4-dione,2,5-difluoro-3,6-dimethoxy structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-difluoro-3,6-dimethoxy | ||
|---|---|---|---|---|
| CAS Number | 653-41-8 | Molecular Weight | 204.12800 | |
| Density | 1.4g/cm3 | Boiling Point | 281.8ºC at 760mmHg | |
| Molecular Formula | C8H6F2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 281.8ºC at 760mmHg |
| Molecular Formula | C8H6F2O4 |
| Molecular Weight | 204.12800 |
| Flash Point | 120.4ºC |
| Exact Mass | 204.02300 |
| PSA | 52.60000 |
| LogP | 0.79320 |
| Index of Refraction | 1.459 |
| InChIKey | WTTYVSBJECNWHV-UHFFFAOYSA-N |
| SMILES | COC1=C(F)C(=O)C(OC)=C(F)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,5-Cyclohexadi... CAS#:653-41-8 |
| Literature: Wallenfels,K.; Friedrich,K. Chemische Berichte, 1960 , vol. 93, p. 3070 - 3082 |
|
~%
2,5-Cyclohexadi... CAS#:653-41-8 |
| Literature: Sah,P.P.T.; Peoples,S.A. Arzneimittel Forschung, 1961 , vol. 11, # 1 p. 27 - 33 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,5-Difluor-3,6-dimethoxy-1,4-benzochinon |
| 2,5-Difluordimethoxy-p-benzoquinon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione? |
| A: The English name of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione is 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione. |
| Q: What is the molecular weight of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione? |
| A: Molecular weight of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione is 204.12800. |
| Q: What is the CAS number of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione? |
| A: CAS number of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione is 653-41-8. |
| Q: What is the LogP of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione? |
| A: LogP of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione is 0.79320. |
| Q: What is the Chinese name of 653-41-8? |
| A: Chinese name of 653-41-8 is 653-41-8. |
| Q: What is the SMILES notation of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione? |
| A: SMILES notation of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione is COC1=C(F)C(=O)C(OC)=C(F)C1=O. |
| Q: What are the upstream materials of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione? |
| A: Related upstream materials(CAS) of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione: 186581-53-3;771-64-2;67-56-1;527-21-9. |
| Q: What is the polar surface area (PSA) of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione? |
| A: Polar surface area (PSA) of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione is 52.60000. |
| Q: What is the boiling point of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione? |
| A: Boiling point of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione is 281.8ºC at 760mmHg. |
| Q: What is the molecular formula of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione? |
| A: Molecular formula of 2,5-difluoro-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione is C8H6F2O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |