Benzenamine,4,4'-[(2-chlorodihydro-2-oxido-1,3,2-diazaphosphorine-1,3(2H,4H)-diyl)bis(methylene)]bis[N,N-dimethyl-(9CI) structure
|
Common Name | Benzenamine,4,4'-[(2-chlorodihydro-2-oxido-1,3,2-diazaphosphorine-1,3(2H,4H)-diyl)bis(methylene)]bis[N,N-dimethyl-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 6533-32-0 | Molecular Weight | 420.91600 | |
| Density | 1.23g/cm3 | Boiling Point | 562ºC at 760mmHg | |
| Molecular Formula | C21H30ClN4OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.7ºC | |
| Name | tetra-N-methyl-4,4'-(2-chloro-2-oxo-2λ5-[1,3,2]diazaphosphinane-1,3-diyldimethyl)-bis-aniline |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 562ºC at 760mmHg |
| Molecular Formula | C21H30ClN4OP |
| Molecular Weight | 420.91600 |
| Flash Point | 293.7ºC |
| Exact Mass | 420.18500 |
| PSA | 39.84000 |
| LogP | 4.74920 |
| Index of Refraction | 1.611 |
| InChIKey | VRKMLMFPYPSMEQ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(CN2CCCN(Cc3ccc(N(C)C)cc3)P2(=O)Cl)cc1 |
|
~%
Benzenamine,4,4... CAS#:6533-32-0 |
| Literature: Billman,J.H. et al. Journal of Medicinal Chemistry, 1966 , vol. 9, p. 772 - 774 |