2(1H)-Quinazolinethione,3,4,5,6,7,8-hexahydro-4-(4-methoxyphenyl) structure
|
Common Name | 2(1H)-Quinazolinethione,3,4,5,6,7,8-hexahydro-4-(4-methoxyphenyl) | ||
|---|---|---|---|---|
| CAS Number | 65331-20-6 | Molecular Weight | 274.38100 | |
| Density | 1.24g/cm3 | Boiling Point | 426.4ºC at 760mmHg | |
| Molecular Formula | C15H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.7ºC | |
| Name | 4-(4-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-quinazoline-2-thione |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 426.4ºC at 760mmHg |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.38100 |
| Flash Point | 211.7ºC |
| Exact Mass | 274.11400 |
| PSA | 65.38000 |
| LogP | 3.69970 |
| Index of Refraction | 1.646 |
| InChIKey | IXHYANNDAFKIIE-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2NC(=S)NC3=C2CCCC3)cc1 |
|
~94%
2(1H)-Quinazoli... CAS#:65331-20-6 |
| Literature: Zhu, Yu-Lin; Huang, Shen-Lin; Pan, Yuan-Jiang European Journal of Organic Chemistry, 2005 , # 11 p. 2354 - 2367 |
|
~84%
2(1H)-Quinazoli... CAS#:65331-20-6 |
| Literature: Minu, Maninder; Thangadurai, Ananda; Wakode, Sharad R.; Agrawal, Shyam S.; Narasimhan, Balasubramanian Archiv der Pharmazie, 2008 , vol. 341, # 4 p. 231 - 239 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |