2-(2-Phenylethyl)-1,3-thiazole-4-carboxylicacid structure
|
Common Name | 2-(2-Phenylethyl)-1,3-thiazole-4-carboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 65346-64-7 | Molecular Weight | 233.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-phenylethyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11NO2S |
|---|---|
| Molecular Weight | 233.28600 |
| Exact Mass | 233.05100 |
| PSA | 78.43000 |
| LogP | 2.62650 |
| InChIKey | JQBNOUSTIWPHQS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1csc(CCc2ccccc2)n1 |
|
~%
2-(2-Phenylethy... CAS#:65346-64-7 |
| Literature: Sagara, Yufu; Mitsuya, Morihiro; Uchiyama, Minaho; Ogino, Yoshio; Kjmura, Toshifumi; Ohtake, Norikazu; Mase, Toshiaki Chemical and Pharmaceutical Bulletin, 2005 , vol. 53, # 4 p. 437 - 440 |
|
~%
2-(2-Phenylethy... CAS#:65346-64-7 |
| Literature: Sagara, Yufu; Mitsuya, Morihiro; Uchiyama, Minaho; Ogino, Yoshio; Kjmura, Toshifumi; Ohtake, Norikazu; Mase, Toshiaki Chemical and Pharmaceutical Bulletin, 2005 , vol. 53, # 4 p. 437 - 440 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Thiazolecarboxylic acid,2-(2-phenylethyl) |