2-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid
2-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid structure
|
Common Name | 2-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6535-70-2 | Molecular Weight | 319.311 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H9NO7S2 |
| Molecular Weight | 319.311 |
| Exact Mass | 318.982056 |
| PSA | 171.75000 |
| LogP | -2.31 |
| Index of Refraction | 1.764 |
| InChIKey | HIVUAOXLSJITPA-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1S(=O)(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2922299090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-Amino-5-hydro... CAS#:6535-70-2 |
| Literature: DE80878 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 578 |
|
~%
2-Amino-5-hydro... CAS#:6535-70-2 |
| Literature: DE80878 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 578 |
|
~%
2-Amino-5-hydro... CAS#:6535-70-2 |
| Literature: DE80878 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 578 |
|
~%
2-Amino-5-hydro... CAS#:6535-70-2 |
| Literature: DE80878 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 578 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid |
| 6-Amino-1-naphthol-3,5-disulfonic acid |
| 3-amino-4,6-disulfo-8-hydroxynaphthalene |
| 3-Amino-8-hydroxy-4,6-disulfonaphthalene |
| 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid |
| 1-hydroxy-6-aminonaphthalene-3,5-disulphonic acid |
| 7-amino-4-hydroxynaphthalene-2,8-disulfonic acid |
| 2-amino-5-hydroxynaphthalene-7,1-disulphonic acid |
| 5-hydroxy-2-aminonaphthalene-1,7-disulphonic acid |
| 2-amino-5-hydroxy-1,7-naphthalenedisulphonic acid |
| 6-amino-1-hydroxynaphthalene-3,5-disulphonic acid |
| 3-AMINONAPHTHALENE-8-HYDROXY-4,6-DISULFONIC ACID |
| 2-amino-5-naphthol-1,7-disulfonic acid |
| MFCD02689077 |
| SULFO J ACID |
| 6-amino-1-hydroxy-3,5-naphthalenedisulfonic acid |
| EINECS 229-445-0 |
| 2-amino-5-hydroxy-naphthalene-1,7-disulfonic acid |
| 6-amino-1-naphthol-3,5-disulphonic acid |
| 3-amino-8-naphthol-4,6-disulfonic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid? |
| A: Related upstream materials(CAS) of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid: 55524-84-0;118-33-2;81-05-0;117-62-4. |
| Q: What is the English name of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid? |
| A: The English name of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid is 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid. |
| Q: What is the molecular formula of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid? |
| A: Molecular formula of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid is C10H9NO7S2. |
| Q: What is the polar surface area (PSA) of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid? |
| A: Polar surface area (PSA) of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid is 171.75000. |
| Q: What is the molecular weight of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid? |
| A: Molecular weight of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid is 319.311. |
| Q: What is the CAS number of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid? |
| A: CAS number of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid is 6535-70-2. |
| Q: What is the SMILES notation of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid? |
| A: SMILES notation of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid is Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1S(=O)(=O)O. |
| Q: What is the LogP of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid? |
| A: LogP of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid is -2.31. |
| Q: What is the InChIKey of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid? |
| A: InChIKey of 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid is HIVUAOXLSJITPA-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |