2-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid structure
|
Common Name | 2-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6535-70-2 | Molecular Weight | 319.311 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H9NO7S2 |
| Molecular Weight | 319.311 |
| Exact Mass | 318.982056 |
| PSA | 171.75000 |
| LogP | -2.31 |
| Index of Refraction | 1.764 |
| InChIKey | HIVUAOXLSJITPA-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1S(=O)(=O)O |
| HS Code | 2922299090 |
|---|
|
~%
2-Amino-5-hydro... CAS#:6535-70-2 |
| Literature: DE80878 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 578 |
|
~%
2-Amino-5-hydro... CAS#:6535-70-2 |
| Literature: DE80878 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 578 |
|
~%
2-Amino-5-hydro... CAS#:6535-70-2 |
| Literature: DE80878 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 578 |
|
~%
2-Amino-5-hydro... CAS#:6535-70-2 |
| Literature: DE80878 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 578 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid |
| 6-Amino-1-naphthol-3,5-disulfonic acid |
| 3-amino-4,6-disulfo-8-hydroxynaphthalene |
| 3-Amino-8-hydroxy-4,6-disulfonaphthalene |
| 2-Amino-5-hydroxynaphthalene-1,7-disulfonic acid |
| 1,7-Naphthalenedisulfonic acid, 2-amino-5-hydroxy- |
| 1-hydroxy-6-aminonaphthalene-3,5-disulphonic acid |
| 7-amino-4-hydroxynaphthalene-2,8-disulfonic acid |
| 2-amino-5-hydroxynaphthalene-7,1-disulphonic acid |
| 5-hydroxy-2-aminonaphthalene-1,7-disulphonic acid |
| 2-amino-5-hydroxy-1,7-naphthalenedisulphonic acid |
| 6-amino-1-hydroxynaphthalene-3,5-disulphonic acid |
| 3-AMINONAPHTHALENE-8-HYDROXY-4,6-DISULFONIC ACID |
| 2-amino-5-naphthol-1,7-disulfonic acid |
| MFCD02689077 |
| SULFO J ACID |
| 6-amino-1-hydroxy-3,5-naphthalenedisulfonic acid |
| EINECS 229-445-0 |
| 2-amino-5-hydroxy-naphthalene-1,7-disulfonic acid |
| 6-amino-1-naphthol-3,5-disulphonic acid |
| 3-amino-8-naphthol-4,6-disulfonic acid |