4-(trans-4-Propylcyclohexyl)benzoic acid structure
|
Common Name | 4-(trans-4-Propylcyclohexyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 65355-29-5 | Molecular Weight | 246.345 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 383.7±21.0 °C at 760 mmHg | |
| Molecular Formula | C16H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.9±16.7 °C | |
| Name | 4-(Trans-4-Propylcyclohexyl)Benzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.7±21.0 °C at 760 mmHg |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.345 |
| Flash Point | 181.9±16.7 °C |
| Exact Mass | 246.161987 |
| PSA | 37.30000 |
| LogP | 5.97 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | VACLULPMEXHBMD-UHFFFAOYSA-N |
| SMILES | CCCC1CCC(c2ccc(C(=O)O)cc2)CC1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 4-(trans-4-propylcyclohexyl)- |
| 4-(trans-4-Propylcyclohexyl)benzoic acid |
| MFCD06658177 |