Z-3-(1-naphthyl)-L-alanine structure
|
Common Name | Z-3-(1-naphthyl)-L-alanine | ||
|---|---|---|---|---|
| CAS Number | 65365-15-3 | Molecular Weight | 349.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | z-1-nal-oh |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H19NO4 |
|---|---|
| Molecular Weight | 349.38000 |
| Exact Mass | 349.13100 |
| PSA | 75.63000 |
| LogP | 4.15280 |
| InChIKey | HNYQEAGTPQSPLT-IBGZPJMESA-N |
| SMILES | O=C(NC(Cc1cccc2ccccc12)C(=O)O)OCc1ccccc1 |
| Storage condition | 2-8°C |
|
~95%
Z-3-(1-naphthyl... CAS#:65365-15-3 |
| Literature: Egusa, Syun; Takagi, Jun; Sisido, Masahiko; Imanishi, Yukio Bulletin of the Chemical Society of Japan, 1986 , vol. 59, # 7 p. 2195 - 2202 |
|
~%
Z-3-(1-naphthyl... CAS#:65365-15-3 |
| Literature: Atsuumi; Nakano; Koike; Tanake; Matsuyama; Morishima Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 2 p. 364 - 370 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-benzyloxycarbonyl-2-n-butoxyglycine n-butyl ester |
| N-benzyloxycarbonyl-L-1-naphthylalanine |