Dimeprozan
Modify Date: 2025-08-23 18:17:57
Dimeprozan structure
|
Common Name | Dimeprozan | ||
|---|---|---|---|---|
| CAS Number | 6538-22-3 | Molecular Weight | 295.37600 | |
| Density | 1.157g/cm3 | Boiling Point | 421.4ºC at 760 mmHg | |
| Molecular Formula | C19H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.7ºC | |
| Name | Dimeprozan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 421.4ºC at 760 mmHg |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.37600 |
| Flash Point | 142.7ºC |
| Exact Mass | 295.15700 |
| PSA | 21.70000 |
| LogP | 4.18430 |
| Index of Refraction | 1.628 |
| InChIKey | CVEKPEDQESUNSP-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(=CCCN(C)C)c1ccccc1O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methoxy-9-<3-dimethylamino-propyliden>-xanthen |