alpha-Hydroxy-beta-methyl-(1,1'-biphenyl)-4-propanoic acid structure
|
Common Name | alpha-Hydroxy-beta-methyl-(1,1'-biphenyl)-4-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 65383-06-4 | Molecular Weight | 256.29600 | |
| Density | 1.198g/cm3 | Boiling Point | 444.9ºC at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237ºC | |
| Name | 2-hydroxy-3-(4-phenylphenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 444.9ºC at 760 mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 237ºC |
| Exact Mass | 256.11000 |
| PSA | 57.53000 |
| LogP | 2.90260 |
| Index of Refraction | 1.595 |
| InChIKey | SDMFWIXCQGKUDE-UHFFFAOYSA-N |
| SMILES | CC(c1ccc(-c2ccccc2)cc1)C(O)C(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-(biphenyl-4-yl)-2-hydroxybutanoic acid |
| Acidi(+-)-eritro E (+-)treo 3-(4-bifenilil)-2-ossibuttrrici [Italian] |
| 3-(4-Biphenylyl)-2-oxy-buttersaeure |