6,7-dimethoxy-2,2-dimethyl-3H-chromen-4-one structure
|
Common Name | 6,7-dimethoxy-2,2-dimethyl-3H-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 65383-61-1 | Molecular Weight | 236.26400 | |
| Density | 1.123g/cm3 | Boiling Point | 357.6ºC at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | 105-107ºC(lit.) | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | 6,7-dimethoxy-2,2-dimethyl-3H-chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 357.6ºC at 760 mmHg |
| Melting Point | 105-107ºC(lit.) |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26400 |
| Flash Point | 158ºC |
| Exact Mass | 236.10500 |
| PSA | 44.76000 |
| LogP | 2.44760 |
| Index of Refraction | 1.509 |
| InChIKey | OMWVNQFGCGNZHE-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(=O)CC(C)(C)O2 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2932999099 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00012092 |
| 2,2-dimethyl-6,7-dimethoxychroman-4-one |
| 6,7-Dimethoxy-2,2-Dimethyl-4-Chloromanone |
| 4H-1-Benzopyran-4-one,2,3-dihydro-6,7-dimethoxy-2,2-dimethyl |
| 6,7-dimethoxy-2,2-dimethyl-4-chromanone |
| EINECS 265-726-4 |
| 6,7-dimethoxy-2,2-dimethyl-chroman-4-one |
| 2,3-dihydro-6,7-dimethoxy-2,2-dimethyl-4H-1-benzopyran-4-one |
| 2,2-Dimethyl-6,7-dimethoxy-4-chromanone |
| 6,7-dimethoxy-2,2-dimethylchromanone |