diphosphoric acid, compound with (aminoiminomethyl)urea (1:4) structure
|
Common Name | diphosphoric acid, compound with (aminoiminomethyl)urea (1:4) | ||
|---|---|---|---|---|
| CAS Number | 65384-84-1 | Molecular Weight | 280.07000 | |
| Density | N/A | Boiling Point | 980.6ºC at 760 mmHg | |
| Molecular Formula | C2H10N4O8P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 546.8ºC | |
| Name | diaminomethylideneurea,phosphono dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 980.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C2H10N4O8P2 |
| Molecular Weight | 280.07000 |
| Flash Point | 546.8ºC |
| Exact Mass | 279.99700 |
| PSA | 249.89000 |
| InChIKey | ROTUFYXLQWBGNR-UHFFFAOYSA-N |
| SMILES | NC(=O)N=C(N)N.O=P(O)(O)OP(=O)(O)O |
| diaminomethylideneurea |
| phosphonooxyphosphonic acid |
| Diphosphoric acid,compound with (aminoiminomethyl)urea (1:4) |
| EINECS 265-729-0 |
| EINECS 284-606-2 |
| Diphosphoric acid,compound with (aminoiminomethyl)urea |