4-Bromo-2-(trifluoromethyl)benzoic acid structure
|
Common Name | 4-Bromo-2-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 654-97-7 | Molecular Weight | 269.015 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 308.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H4BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.2±27.9 °C | |
| Name | 5-Bromo-2-Trifluoromethylbenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.2±42.0 °C at 760 mmHg |
| Molecular Formula | C8H4BrF3O2 |
| Molecular Weight | 269.015 |
| Flash Point | 140.2±27.9 °C |
| Exact Mass | 267.934662 |
| PSA | 37.30000 |
| LogP | 3.43 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | SWSCMXZZHFRZLX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Br)ccc1C(F)(F)F |
| Storage condition | 2-8°C |
| HS Code | 2916399090 |
|---|
|
~93%
4-Bromo-2-(trif... CAS#:654-97-7 |
| Literature: SIGNAL PHARMACEUTICALS, LLC Patent: WO2009/89042 A1, 2009 ; Location in patent: Page/Page column 101 ; WO 2009/089042 A1 |
|
~82%
4-Bromo-2-(trif... CAS#:654-97-7 |
| Literature: Lishchynskyi, Anton; Novikov, Maxim A.; Martin, Eddy; Escudero-Adan, Eduardo C.; Novak, Petr; Grushin, Vladimir V. Journal of Organic Chemistry, 2013 , vol. 78, # 22 p. 11126 - 11146 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 4-bromo-2-(trifluoromethyl)- |
| Benzoic acid, 5-bromo-2-(trifluoromethyl)- |
| QVR DE BXFFF |
| 5-Bromo-2-(trifluoromethyl)benzoic acid |
| 4-Bromo-α,α,α-Trifluoro-o-toluic acid |
| 4-Bromo-2-(trifluoromethyl)benzoic acid |