4-(2-formylvinyl)-2-methoxyphenyl acetate structure
|
Common Name | 4-(2-formylvinyl)-2-methoxyphenyl acetate | ||
|---|---|---|---|---|
| CAS Number | 65401-83-4 | Molecular Weight | 220.22100 | |
| Density | 1.162g/cm3 | Boiling Point | 342.7ºC at 760 mmHg | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.4ºC | |
| Name | 4-acetoxy-3-methoxy-trans-cinnamaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 342.7ºC at 760 mmHg |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| Flash Point | 151.4ºC |
| Exact Mass | 220.07400 |
| PSA | 52.60000 |
| LogP | 1.83260 |
| Index of Refraction | 1.55 |
| InChIKey | VEKAJHBFBMWJKI-ONEGZZNKSA-N |
| SMILES | COc1cc(C=CC=O)ccc1OC(C)=O |
| HS Code | 2915390090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| (E)-3-(4-acetoxy-3-methoxyphenyl)propenal |
| 2-Propenal,3-[4-(acetyloxy)-3-methoxyphenyl] |
| (E)-2-methoxy-4-(3-oxoprop-1-enyl)phenyl ethanoate |
| (E)-4-acetoxy-3-methoxycinnamaldehyde |
| (E)-2-methoxy-4-(3-oxoprop-1-enyl)phenyl acetate |
| 4-Acetoxy-3-methoxy-trans-zimtaldehyd |
| [2-methoxy-4-(3-oxoprop-1-enyl)phenyl] acetate |
| 4-Acetoxy-3-methoxycinnamaldehyde,predominantly trans |
| 3-methoxy-4-acetoxycinnamaldehyde |