(4-tert-butylphenyl)methyl-triphenylphosphanium,bromide structure
|
Common Name | (4-tert-butylphenyl)methyl-triphenylphosphanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 65413-33-4 | Molecular Weight | 489.42600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H30BrP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-tert-butylphenyl)methyl-triphenylphosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C29H30BrP |
|---|---|
| Molecular Weight | 489.42600 |
| Exact Mass | 488.12700 |
| PSA | 13.59000 |
| LogP | 3.48220 |
| InChIKey | QIKUTCHXSCUWLM-UHFFFAOYSA-M |
| SMILES | CC(C)(C)c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[Br-] |
|
~93%
(4-tert-butylph... CAS#:65413-33-4 |
| Literature: Mylona, Anastasia; Nikokavouras, John; Takakis, Ioannis M. Journal of Chemical Research, Miniprint, 1986 , # 12 p. 3514 - 3530 |
|
~%
(4-tert-butylph... CAS#:65413-33-4 |
| Literature: Kagechika; Himi; Namikawa; Kawachi; Hashimoto; Shudo Journal of Medicinal Chemistry, 1989 , vol. 32, # 5 p. 1098 - 1108 |
| Phosphonium,[[4-(1,1-dimethylethyl)phenyl]methyl]triphenyl-,bromide |
| (4-t-butylbenzyl)triphenylphosphonium bromide |
| 4-(tert-butylbenzyl)triphenylphosphonium bromide |
| p-tert-butylbenzyl(triphenyl)phosphonium bromide |