Oxabrexine
Modify Date: 2025-09-18 10:52:46
Oxabrexine structure
|
Common Name | Oxabrexine | ||
|---|---|---|---|---|
| CAS Number | 65415-42-1 | Molecular Weight | 463.20400 | |
| Density | 1.49g/cm3 | Boiling Point | 476.5ºC at 760 mmHg | |
| Molecular Formula | C18H25Br2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242ºC | |
| Name | Ethyl (2,4-dibromo-6-{[cyclohexyl(methyl)amino]methyl}phenoxy)ace tate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 476.5ºC at 760 mmHg |
| Molecular Formula | C18H25Br2NO3 |
| Molecular Weight | 463.20400 |
| Flash Point | 242ºC |
| Exact Mass | 461.02000 |
| PSA | 38.77000 |
| LogP | 4.91800 |
| Index of Refraction | 1.581 |
| InChIKey | RMBSXTDJPPLMFP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1c(Br)cc(Br)cc1CN(C)C1CCCCC1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-<2-(Carbethoxy-methoxy)-3,5-dibromobenzyl>-N-methyl-cyclohexylamin |
| N-<2-(Benzylthio)-ethyl>-2-(2,4-dichlor-phenoxy)-acetamid |