2,2,2-trichloro-1-phenylethyl phenylacetate
Modify Date: 2025-09-28 21:39:15
2,2,2-trichloro-1-phenylethyl phenylacetate structure
|
Common Name | 2,2,2-trichloro-1-phenylethyl phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 65416-22-0 | Molecular Weight | 343.63200 | |
| Density | 1.35g/cm3 | Boiling Point | 458.7ºC at 760 mmHg | |
| Molecular Formula | C16H13Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.2ºC | |
| Name | (2,2,2-trichloro-1-phenylethyl) 2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 458.7ºC at 760 mmHg |
| Molecular Formula | C16H13Cl3O2 |
| Molecular Weight | 343.63200 |
| Flash Point | 176.2ºC |
| Exact Mass | 341.99800 |
| PSA | 26.30000 |
| LogP | 4.88380 |
| Index of Refraction | 1.589 |
| InChIKey | XBNCLGQQXMCUGV-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)OC(c1ccccc1)C(Cl)(Cl)Cl |
| HS Code | 2916399090 |
|---|
|
~%
2,2,2-trichloro... CAS#:65416-22-0 |
| Literature: Mitchell Perfumery and Essential Oil Record, 1950 , vol. 41, p. 41 |
|
~%
2,2,2-trichloro... CAS#:65416-22-0 |
| Literature: Mitchell Perfumery and Essential Oil Record, 1950 , vol. 41, p. 41 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Phenyl-essigsaeure-(2,2,2-trichlor-1-phenyl-aethylester) |
| phenyl-acetic acid-(2,2,2-trichloro-1-phenyl-ethyl ester) |
| 2,2,2-Trichloro-1-phenylethyl phenylacetate |
| EINECS 265-762-0 |
| Trichlormethylphenylcarbinol,phenyl acetate |