bis[(2Z)-3,7-dimethylocta-2,6-dienyl] [(2E)-3,7-dimethylocta-2,6-dienyl] borate structure
|
Common Name | bis[(2Z)-3,7-dimethylocta-2,6-dienyl] [(2E)-3,7-dimethylocta-2,6-dienyl] borate | ||
|---|---|---|---|---|
| CAS Number | 65416-33-3 | Molecular Weight | 470.53500 | |
| Density | 0.895g/cm3 | Boiling Point | 510.5ºC at 760mmHg | |
| Molecular Formula | C30H51BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.2ºC | |
| Name | bis[(2Z)-3,7-dimethylocta-2,6-dienyl] [(2E)-3,7-dimethylocta-2,6-dienyl] borate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.895g/cm3 |
|---|---|
| Boiling Point | 510.5ºC at 760mmHg |
| Molecular Formula | C30H51BO3 |
| Molecular Weight | 470.53500 |
| Flash Point | 191.2ºC |
| Exact Mass | 470.39300 |
| PSA | 27.69000 |
| LogP | 9.09920 |
| Index of Refraction | 1.479 |
| InChIKey | PKMAPPRYHGGQHW-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C)=CCOB(OCC=C(C)CCC=C(C)C)OCC=C(C)CCC=C(C)C |
|
~%
bis[(2Z)-3,7-di... CAS#:65416-33-3 |
| Literature: Wuyts; Duquesne Bulletin des Societes Chimiques Belges, 1939 , vol. 48, p. 77,85 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 265-769-9 |
| 2,6-Octadien-1-ol,3,7-dimethyl-,triester with boric acid (H3BO3),(2E,2'E,2''E) |
| 3,7-Dimethyl-2-trans-6-octadienol borate |
| Trigeranylborat |
| triester with boric acid |
| Tris((E)-3,7-dimethylocta-2,6-dien-1-ol),triester with boric acid |
| tris[(E)-3,7-dimethylocta-2,6-dien-1-ol] |
| 2,6-Octadien-1-ol,3,7-dimethyl-,1,1',1''-triester with boric acid (H3BO3),(2E,2'E,2''E) |
| boric acid tris-(3,7-dimethyl-octa-2,6-dienyl ester) |
| Borsaeure-tris-(3,7-dimethyl-octa-2,6-dienylester) |