N-(3-methylbutyl)-2-[(4-methylphenyl)amino]pyridine-3-carboxamide structure
|
Common Name | N-(3-methylbutyl)-2-[(4-methylphenyl)amino]pyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 65423-31-6 | Molecular Weight | 297.39500 | |
| Density | 1.094g/cm3 | Boiling Point | 483.5ºC at 760 mmHg | |
| Molecular Formula | C18H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.2ºC | |
| Name | 2-(4-methylanilino)-N-(3-methylbutyl)pyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 483.5ºC at 760 mmHg |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.39500 |
| Flash Point | 246.2ºC |
| Exact Mass | 297.18400 |
| PSA | 57.51000 |
| LogP | 4.55730 |
| Index of Refraction | 1.581 |
| InChIKey | FRYPJQVPJVDNLJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2ncccc2C(=O)NCCC(C)C)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Isopentyl-2-(p-methylanilino)nicotinamide |
| Nicotinamide,N-isopentyl-2-(p-methylanilino) |
| 2-(4-methyl-anilino)-N-(3-methyl-butyl)-nicotinamide |
| N-Isopentyl-2-(p-toluidino)nicotinamide |
| Nicotinamide,N-isopentyl-2-(p-toluidino) |
| N-(3-METHYLBUTYL)-2-[(4-METHYLPHENYL)AMINO]PYRIDINE-3-CARBOXAMIDE |