4'-O-METHYLDAVIDIGENIN structure
|
Common Name | 4'-O-METHYLDAVIDIGENIN | ||
|---|---|---|---|---|
| CAS Number | 65428-04-8 | Molecular Weight | 272.29600 | |
| Density | 1.243g/cm3 | Boiling Point | 503.4ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.6ºC | |
| Name | 1-(2-hydroxy-4-methoxyphenyl)-3-(4-hydroxyphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 503.4ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 189.6ºC |
| Exact Mass | 272.10500 |
| PSA | 66.76000 |
| LogP | 2.92190 |
| Index of Refraction | 1.609 |
| InChIKey | MEZSKKITJGNMJJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCc2ccc(O)cc2)c(O)c1 |
| HS Code | 2914509090 |
|---|
|
~15%
4'-O-METHYLDAVI... CAS#:65428-04-8 |
| Literature: Kostrzewa-Suslow, Edyta; Janeczko, Tomasz Molecules, 2012 , vol. 17, # 12 p. 14810 - 14820 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4'-O-Methyldavidigenin |
| 4,2'-dihydroxy-4'-methoxydihydrochalcone |
| 2',4-dihydroxy-4'-methoxydihydrochalcone |