4-ethoxy-4-oxo-3-(triphenyl-λ5-phosphanylidene)butanoate structure
|
Common Name | 4-ethoxy-4-oxo-3-(triphenyl-λ5-phosphanylidene)butanoate | ||
|---|---|---|---|---|
| CAS Number | 65434-72-2 | Molecular Weight | 405.40300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H22O4P- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethoxy-4-oxo-3-(triphenyl-λ5-phosphanylidene)butanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H22O4P- |
|---|---|
| Molecular Weight | 405.40300 |
| Exact Mass | 405.12600 |
| PSA | 76.24000 |
| LogP | 1.85600 |
| InChIKey | FXMXQZFRACBYPA-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C(CC(=O)[O-])=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~%
4-ethoxy-4-oxo-... CAS#:65434-72-2 |
| Literature: Bacaloglu, Radu; Blasko, Andrei; Bunton, Clifford A.; Cerichelli, Giorgio; Castaneda, Fernando; Rivera, Enrique Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1995 , # 5 p. 965 - 972 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Ethyl hydrogen 2-(triphenylphosphanylidene)butane-1,4-dioate |
| Butanedioic acid,(triphenylphosphoranylidene)-,1-ethyl ester |