ethyl N-[(4-chlorophenyl)carbamoyl]carbamate structure
|
Common Name | ethyl N-[(4-chlorophenyl)carbamoyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 65440-23-5 | Molecular Weight | 242.65900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[(4-chlorophenyl)carbamoyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11ClN2O3 |
|---|---|
| Molecular Weight | 242.65900 |
| Exact Mass | 242.04600 |
| PSA | 70.92000 |
| LogP | 2.89540 |
| InChIKey | JPDDTENJDQJJNX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(=O)Nc1ccc(Cl)cc1 |
|
~%
ethyl N-[(4-chl... CAS#:65440-23-5 |
| Literature: Curd et al. Journal of the Chemical Society, 1949 , p. 1739,1742 |
| 4-(4-Chlor-phenyl)-allophansaeure-aethylester |
| Carbamic acid,[[(4-chlorophenyl)amino]carbonyl]-,ethyl ester |
| 4-(4-chloro-phenyl)-allophanic acid ethyl ester |
| N-(4-chlorophenyl)-N'carbaethoxyharnstoff |