3H-Pyrazol-3-ol,4,5-dihydro-3,5,5-trimethyl-, 3-benzoate, 1-oxide structure
|
Common Name | 3H-Pyrazol-3-ol,4,5-dihydro-3,5,5-trimethyl-, 3-benzoate, 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 65441-83-0 | Molecular Weight | 248.27800 | |
| Density | 1.18g/cm3 | Boiling Point | 351ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.1ºC | |
| Name | (3,5,5-trimethyl-1-oxido-4H-pyrazol-1-ium-3-yl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 351ºC at 760 mmHg |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.27800 |
| Flash Point | 166.1ºC |
| Exact Mass | 248.11600 |
| PSA | 67.41000 |
| LogP | 2.09880 |
| Index of Refraction | 1.562 |
| InChIKey | UUWGGTKQWYTOGN-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)c2ccccc2)CC(C)(C)[N+]([O-])=N1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3H-Pyrazol-3-ol,4,5-dihydro-3,5,5-trimethyl-,3-benzoate,1-oxide |
| 1-Pyrazolin-3-ol,3,5,5-trimethyl-,benzoate (ester),1-oxide (7CI) |
| (3,5,5-TRIMETHYL-1-OXIDO-4H-PYRAZOL-3-YL) BENZOATE |
| 3H-Pyrazol-3-ol,4,5-dihydro-3,5,5-trimethyl-,benzoate (ester),1-oxide (9CI) |
| 3-benzoyloxy-3,5,5-trimethyl-4,5-dihydro-3H-pyrazole 1-oxide |