Phosphoric acid 2-methoxyethyldiphenyl ester structure
|
Common Name | Phosphoric acid 2-methoxyethyldiphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 65444-10-2 | Molecular Weight | 308.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methoxyethyl diphenyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17O5P |
|---|---|
| Molecular Weight | 308.26600 |
| Exact Mass | 308.08100 |
| PSA | 63.80000 |
| LogP | 3.91550 |
| InChIKey | ZGPIVNOGYHJEMI-UHFFFAOYSA-N |
| SMILES | COCCOP(=O)(Oc1ccccc1)Oc1ccccc1 |
| HS Code | 2919900090 |
|---|
|
~88%
Phosphoric acid... CAS#:65444-10-2 |
| Literature: Kasemsuknimit, Atthapol; Satyender, Apuri; Chavasiri, Warinthorn; Jang, Doo Ok Bulletin of the Korean Chemical Society, 2011 , vol. 32, # 9 p. 3486 - 3488 |
|
~%
Phosphoric acid... CAS#:65444-10-2 |
| Literature: Cramer; Gaertner Chemische Berichte, 1958 , vol. 91, p. 1562,1566 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phosphoric acid,2-methoxyethyl diphenyl ester |
| Phosphorsaeure-(2-methoxy-aethylester)-diphenylester |
| phosphoric acid-(2-methoxy-ethyl ester)-diphenyl ester |