(DL)-N-(Phenylacetyl)-3-amino-3-phenylpropanoic acid structure
|
Common Name | (DL)-N-(Phenylacetyl)-3-amino-3-phenylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 65451-19-6 | Molecular Weight | 283.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-phenyl-3-[(2-phenylacetyl)amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H17NO3 |
|---|---|
| Molecular Weight | 283.32200 |
| Exact Mass | 283.12100 |
| PSA | 69.89000 |
| LogP | 3.40160 |
| InChIKey | URKWJOAJRKPEFW-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(NC(=O)Cc1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~75%
(DL)-N-(Phenyla... CAS#:65451-19-6 |
| Literature: Cardillo, Giuliana; Gentilucci, Luca; Melchiorre, Paolo; Spampinato, Santi Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 24 p. 2755 - 2758 |
|
~%
(DL)-N-(Phenyla... CAS#:65451-19-6 |
| Literature: Cardillo; Gentilucci; Tolomelli; Tomasini Journal of Organic Chemistry, 1998 , vol. 63, # 7 p. 2351 - 2353 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (S)-3-PHENYL-3-PHENYLACETYLAMINO-PROPIONIC ACID |
| N-(phenylacetyl)-3-amino-3-phenylpropanoic acid |
| (DL)-N-(PHENYLACETYL)-3-AMINO-3-PHENYLPROPANOIC ACID |
| 3-Phenyl-3-phenylacetylamino-propionic acid |