N-(2-((3-(furan-3-ylmethyl)-6,11-dimethyl-1,2,3,4,5,6-hexahydro-2,6-methanobenzo[d]azocin-8-yl)oxy)-2-oxoethyl)methacrylimidic acid compound with methacrylimidic acid (1:1) structure
|
Common Name | N-(2-((3-(furan-3-ylmethyl)-6,11-dimethyl-1,2,3,4,5,6-hexahydro-2,6-methanobenzo[d]azocin-8-yl)oxy)-2-oxoethyl)methacrylimidic acid compound with methacrylimidic acid (1:1) | ||
|---|---|---|---|---|
| CAS Number | 65452-09-7 | Molecular Weight | 507.62100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H37N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-((3-(furan-3-ylmethyl)-6,11-dimethyl-1,2,3,4,5,6-hexahydro-2,6-methanobenzo[d]azocin-8-yl)oxy)-2-oxoethyl)methacrylimidic acid compound with methacrylimidic acid (1:1) |
|---|
| Molecular Formula | C29H37N3O5 |
|---|---|
| Molecular Weight | 507.62100 |
| Exact Mass | 507.27300 |
| PSA | 119.35000 |
| LogP | 5.57740 |
| InChIKey | KYBRAVIYUGNBTO-PMZUHCFUSA-N |
| SMILES | C=C(C)C(=O)NCC(=O)Oc1ccc2c(c1)C1(C)CCN(Cc3ccoc3)C(C2)C1C.C=C(C)C(N)=O |