(3S,6R)-Lateritin structure
|
Common Name | (3S,6R)-Lateritin | ||
|---|---|---|---|---|
| CAS Number | 65454-13-9 | Molecular Weight | 261.31600 | |
| Density | 1.126g/cm3 | Boiling Point | 456.8ºC at 760 mmHg | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.1ºC | |
Use of (3S,6R)-LateritinLateritin is An Acyl-CoA:cholesterol acyltransferase (ACAT) inhibitor and a platelet aggregation inhibitor isolated from the mycelial cake of Gibberella lateritium; bassiatin is the (3S,6R) isomer. |
| Name | bassiatin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 456.8ºC at 760 mmHg |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.31600 |
| Flash Point | 230.1ºC |
| Exact Mass | 261.13600 |
| PSA | 46.61000 |
| LogP | 1.57540 |
| Index of Refraction | 1.529 |
| InChIKey | YOKBTBNVNCFOBF-UHFFFAOYSA-N |
| SMILES | CC(C)C1OC(=O)C(Cc2ccccc2)N(C)C1=O |
| Storage condition | -20°C |
| Lateritin |
| Lateritine |
| Bassiatin |
| 3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione |
| 2,5-Morpholinedione,4-methyl-6-(1-methylethyl)-3-(phenylmethyl) |