1,1'-diamino-2,2'-bianthraquinone
Modify Date: 2025-08-25 15:15:36
1,1'-diamino-2,2'-bianthraquinone structure
|
Common Name | 1,1'-diamino-2,2'-bianthraquinone | ||
|---|---|---|---|---|
| CAS Number | 6546-50-5 | Molecular Weight | 444.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-2-(1-amino-9,10-dioxoanthracen-2-yl)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H16N2O4 |
|---|---|
| Molecular Weight | 444.43800 |
| Exact Mass | 444.11100 |
| PSA | 120.32000 |
| LogP | 5.23120 |
| InChIKey | GHPKHIZDZZWUEZ-UHFFFAOYSA-N |
| SMILES | Nc1c(-c2ccc3c(c2N)C(=O)c2ccccc2C3=O)ccc2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~%
1,1'-diamino-2,... CAS#:6546-50-5 |
| Literature: I. G. Farbenind. Patent: DE470550 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 1347 |
|
~%
1,1'-diamino-2,... CAS#:6546-50-5 |
| Literature: I.G. Farbenind. Patent: DE470550 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 1347 |
|
~%
1,1'-diamino-2,... CAS#:6546-50-5 |
| Literature: I.G. Farbenind. Patent: DE470550 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 1347 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:4229-15-6| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,1'-diamino-[2,2']bianthryl-9,10,9',10'-tetraone |
| 1,1'-Diamino-2,2'-dianthrachinonyl |
| 1,1'-DIAMINO-2,2'-BIANTHRAQUINONE |
| 1.1'-Diamino-dianthrachinonyl-(2.2') |