dimethyl 2-(3-phenylbut-2-enyl)propanedioate structure
|
Common Name | dimethyl 2-(3-phenylbut-2-enyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 654640-19-4 | Molecular Weight | 262.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2-(3-phenylbut-2-enyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H18O4 |
|---|---|
| Molecular Weight | 262.30100 |
| Exact Mass | 262.12100 |
| PSA | 52.60000 |
| LogP | 2.44220 |
| InChIKey | JYBCIYXHEMJWCY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC=C(C)c1ccccc1)C(=O)OC |
|
~%
dimethyl 2-(3-p... CAS#:654640-19-4 |
| Literature: Luzung, Michael R.; Mauleon, Pablo; Toste, F. Dean Journal of the American Chemical Society, 2007 , vol. 129, # 41 p. 12402 - 12403 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| dimethyl trans-2-(3'-phenylbut-2'-enyl)malonate |
| Propanedioic acid,[(2E)-3-phenyl-2-butenyl]-,dimethyl ester |
| dimethyl 2-phenyl-2-pentene-5,5-dicarboxylate |