2-[(2-fluorophenyl)methylideneamino]-5-phenyldiazenylbenzoic acid structure
|
Common Name | 2-[(2-fluorophenyl)methylideneamino]-5-phenyldiazenylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 654649-12-4 | Molecular Weight | 347.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2-fluorophenyl)methylideneamino]-5-phenyldiazenylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H14FN3O2 |
|---|---|
| Molecular Weight | 347.34200 |
| Exact Mass | 347.10700 |
| PSA | 74.38000 |
| LogP | 5.68990 |
| InChIKey | HYTNRBPTBMQXQF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(N=Nc2ccccc2)ccc1N=Cc1ccccc1F |
|
~%
2-[(2-fluorophe... CAS#:654649-12-4 |
| Literature: Kumar, Ashok; Bansal, Deepti; Bajaj, Kiran; Sharma, Shalabh; Archana; Srivastava Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 23 p. 5281 - 5291 |
|
~%
2-[(2-fluorophe... CAS#:654649-12-4 |
| Literature: Kumar, Ashok; Bansal, Deepti; Bajaj, Kiran; Sharma, Shalabh; Archana; Srivastava Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 23 p. 5281 - 5291 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,2-[[(2-fluorophenyl)methylene]amino]-5-(phenylazo) |
| N-(o-fluorobenzylidene)-5-(phenylazo)anthranilic acid |