dibenzyl 2-(2,2-dimethoxyethyl)propanedioate structure
|
Common Name | dibenzyl 2-(2,2-dimethoxyethyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 654673-32-2 | Molecular Weight | 372.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dibenzyl 2-(2,2-dimethoxyethyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H24O6 |
|---|---|
| Molecular Weight | 372.41200 |
| Exact Mass | 372.15700 |
| PSA | 71.06000 |
| LogP | 3.09840 |
| InChIKey | FMUBJXVNTVZWSC-UHFFFAOYSA-N |
| SMILES | COC(CC(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1)OC |
|
~49%
dibenzyl 2-(2,2... CAS#:654673-32-2 |
| Literature: Vignola, Nicola; List, Benjamin Journal of the American Chemical Society, 2004 , vol. 126, # 2 p. 450 - 451 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Propanedioic acid,(2,2-dimethoxyethyl)-,bis(phenylmethyl) ester |