1(3H)-Isobenzofuranone,7-(chloromethyl)-4,5,6-trimethoxy- structure
|
Common Name | 1(3H)-Isobenzofuranone,7-(chloromethyl)-4,5,6-trimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 6547-34-8 | Molecular Weight | 272.68200 | |
| Density | 1.325g/cm3 | Boiling Point | 343.6ºC at 760 mmHg | |
| Molecular Formula | C12H13ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.6ºC | |
| Name | 7-(chloromethyl)-4,5,6-trimethoxy-3H-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 343.6ºC at 760 mmHg |
| Molecular Formula | C12H13ClO5 |
| Molecular Weight | 272.68200 |
| Flash Point | 136.6ºC |
| Exact Mass | 272.04500 |
| PSA | 53.99000 |
| LogP | 2.12160 |
| Index of Refraction | 1.547 |
| InChIKey | UNZNABLCQIHCLL-UHFFFAOYSA-N |
| SMILES | COc1c(CCl)c2c(c(OC)c1OC)COC2=O |
|
~92%
1(3H)-Isobenzof... CAS#:6547-34-8 |
| Literature: Bhattacharjee, Debkumar; Popp, Frank D. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 315 - 320 |
|
~%
1(3H)-Isobenzof... CAS#:6547-34-8 |
| Literature: Haworth et al. Journal of the Chemical Society, 1954 , p. 3617,3622 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 7-Chlormethyl-4,5,6-trimethoxy-phthalid |
| 7-chloromethyl-4,5,6-trimethoxy-phthalide |