2-[(2-aminophenyl)methyl-methylamino]-1-phenylethanol structure
|
Common Name | 2-[(2-aminophenyl)methyl-methylamino]-1-phenylethanol | ||
|---|---|---|---|---|
| CAS Number | 65514-97-8 | Molecular Weight | 256.34300 | |
| Density | 1.146g/cm3 | Boiling Point | 435.333ºC at 760 mmHg | |
| Molecular Formula | C16H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.082ºC | |
| Name | 2-[(2-aminophenyl)methyl-methylamino]-1-phenylethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 435.333ºC at 760 mmHg |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.34300 |
| Flash Point | 217.082ºC |
| Exact Mass | 256.15800 |
| PSA | 49.49000 |
| LogP | 3.01540 |
| Index of Refraction | 1.624 |
| InChIKey | DVGIYWMJXYCEFJ-UHFFFAOYSA-N |
| SMILES | CN(Cc1ccccc1N)CC(O)c1ccccc1 |
| HS Code | 2922199090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenemethanol,a-[[[(2-aminophenyl)methyl]methylamino]methyl] |
| EINECS 265-803-2 |
| N-(2-Aminobenzyl)-2-(methylamino)-1-phenyl-1-ethanol |
| N-(2-amino-benzyl)-1-phenyl-2-methylamino-1-ethanol |