ethyl 2-(carbamoylmethyl)-1H-pyrrole-3-carboxylate structure
|
Common Name | ethyl 2-(carbamoylmethyl)-1H-pyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 65523-04-8 | Molecular Weight | 196.20300 | |
| Density | 1.259g/cm3 | Boiling Point | 505.8ºC at 760 mmHg | |
| Molecular Formula | C9H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.7ºC | |
| Name | ethyl 2-(2-amino-2-oxoethyl)-1H-pyrrole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 505.8ºC at 760 mmHg |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.20300 |
| Flash Point | 259.7ºC |
| Exact Mass | 196.08500 |
| PSA | 85.18000 |
| LogP | 0.91950 |
| Index of Refraction | 1.557 |
| InChIKey | PZDFQDIKMABNEE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc[nH]c1CC(N)=O |
|
~%
ethyl 2-(carbam... CAS#:65523-04-8 |
| Literature: Schneller; Luo; Hosmane Tetrahedron Letters, 1980 , vol. 21, # 33 p. 3135 - 3138 |
|
~%
ethyl 2-(carbam... CAS#:65523-04-8 |
| Literature: Schneller, Stewart W.; Luo, Jiann-Kuan; Hosmane, Ramachandra S.; Clerqu, Erik De; Stoeckler, Johanna D.; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1737 - 1739 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(Ethoxycarbonyl)pyrrole-2-acetamide |
| 2-carbamoylmethyl-pyrrole-3-carboxylic acid ethyl ester |
| ETHYL 2-(CARBAMOYLMETHYL)-1H-PYRROLE-3-CARBOXYLATE |
| 3-(Ethoxycarbonyl)pyrrol-2-acetamid |