Pentanedioic acid,2-cyano-3-imino-, 1,5-diethyl ester structure
|
Common Name | Pentanedioic acid,2-cyano-3-imino-, 1,5-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 65523-05-9 | Molecular Weight | 226.22900 | |
| Density | 1.17g/cm3 | Boiling Point | 404.9ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.7ºC | |
| Name | diethyl 2-cyano-3-iminopentanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 404.9ºC at 760 mmHg |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.22900 |
| Flash Point | 198.7ºC |
| Exact Mass | 226.09500 |
| PSA | 100.24000 |
| LogP | 0.76198 |
| Index of Refraction | 1.497 |
| InChIKey | XBOMYZCTRIMBMW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=N)C(C#N)C(=O)OCC |
| HS Code | 2926909090 |
|---|
|
~%
Pentanedioic ac... CAS#:65523-05-9 |
| Literature: Ingold; Powell Journal of the Chemical Society, 1921 , vol. 119, p. 1228 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-cyano-3-imino-glutaric acid diethyl ester |
| 2-Imino-1-cyan-propan-dicarbonsaeure-(1,3)-diaethylester |
| diethyl(3e)-2-cyano-3-iminopentanedioate |
| 2-Cyan-3-imino-glutarsaeure-diaethylester |