(3-bromophenyl)-(3-methylazulen-1-yl)methanone
(3-bromophenyl)-(3-methylazulen-1-yl)methanone structure
|
Common Name | (3-bromophenyl)-(3-methylazulen-1-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 655237-27-7 | Molecular Weight | 325.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H13BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (3-Bromophenyl)-(3-methylazulen-1-yl)methanone, Chinese name not provided, CAS number 655237-27-7, molecular formula C18H13BrO, molecular weight 325.19900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3-bromophenyl)-(3-methylazulen-1-yl)methanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H13BrO |
|---|---|
| Molecular Weight | 325.19900 |
| Exact Mass | 324.01500 |
| PSA | 17.07000 |
| LogP | 5.09330 |
| InChIKey | CLDMMEKPCGAICA-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)c2cccc(Br)c2)c2cccccc1-2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~26%
(3-bromophenyl)... CAS#:655237-27-7 |
| Literature: Ikegai, Kazuhiro; Imamura, Masakazu; Suzuki, Takayuki; Nakanishi, Keita; Murakami, Takeshi; Kurosaki, Eiji; Noda, Atsushi; Kobayashi, Yoshinori; Yokota, Masayuki; Koide, Tomokazu; Kosakai, Kazuhiro; Ohkura, Yasufumi; Takeuchi, Makoto; Tomiyama, Hiroshi; Ohta, Mitsuaki Bioorganic and Medicinal Chemistry, 2013 , vol. 21, # 13 p. 3934 - 3948 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (3-bromophenyl)(3-methylazulen-1-yl)methanone |
| Methanone,(3-bromophenyl)(3-methyl-1-azulenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (3-bromophenyl)-(3-methylazulen-1-yl)methanone? |
| A: LogP of (3-bromophenyl)-(3-methylazulen-1-yl)methanone is 5.09330. |
| Q: What is the SMILES notation of (3-bromophenyl)-(3-methylazulen-1-yl)methanone? |
| A: SMILES notation of (3-bromophenyl)-(3-methylazulen-1-yl)methanone is Cc1cc(C(=O)c2cccc(Br)c2)c2cccccc1-2. |
| Q: What is the polar surface area (PSA) of (3-bromophenyl)-(3-methylazulen-1-yl)methanone? |
| A: Polar surface area (PSA) of (3-bromophenyl)-(3-methylazulen-1-yl)methanone is 17.07000. |
| Q: What is the CAS number of (3-bromophenyl)-(3-methylazulen-1-yl)methanone? |
| A: CAS number of (3-bromophenyl)-(3-methylazulen-1-yl)methanone is 655237-27-7. |
| Q: What is the InChIKey of (3-bromophenyl)-(3-methylazulen-1-yl)methanone? |
| A: InChIKey of (3-bromophenyl)-(3-methylazulen-1-yl)methanone is CLDMMEKPCGAICA-UHFFFAOYSA-N. |
| Q: What are the upstream materials of (3-bromophenyl)-(3-methylazulen-1-yl)methanone? |
| A: Related upstream materials(CAS) of (3-bromophenyl)-(3-methylazulen-1-yl)methanone: 1711-09-7;769-31-3. |
| Q: What is the molecular weight of (3-bromophenyl)-(3-methylazulen-1-yl)methanone? |
| A: Molecular weight of (3-bromophenyl)-(3-methylazulen-1-yl)methanone is 325.19900. |
| Q: What is the English name of (3-bromophenyl)-(3-methylazulen-1-yl)methanone? |
| A: The English name of (3-bromophenyl)-(3-methylazulen-1-yl)methanone is (3-bromophenyl)-(3-methylazulen-1-yl)methanone. |
| Q: What is the Chinese name of 655237-27-7? |
| A: Chinese name of 655237-27-7 is 655237-27-7. |
| Q: What English synonyms does (3-bromophenyl)-(3-methylazulen-1-yl)methanone have? |
| A: English synonyms of (3-bromophenyl)-(3-methylazulen-1-yl)methanone: (3-bromophenyl)(3-methylazulen-1-yl)methanone, Methanone,(3-bromophenyl)(3-methyl-1-azulenyl). |