4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline
Modify Date: 2026-07-01 11:54:25
![4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline Structure](https://www.chemsrc.com/extcaspic/300/65538-43-4.png)
4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline structure
|
Common Name | 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline | ||
|---|---|---|---|---|
| CAS Number | 65538-43-4 | Molecular Weight | 425.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19Br2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H19Br2N3 |
|---|---|
| Molecular Weight | 425.2 |
| InChIKey | GZKOFHDUGZXKEA-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(N=Nc2c(C)cc(Br)cc2Br)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline? |
| A: The English name of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline is 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline. |
| Q: What is the SMILES notation of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline? |
| A: SMILES notation of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline is CCN(CC)c1ccc(N=Nc2c(C)cc(Br)cc2Br)cc1. |
| Q: What is the CAS number of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline? |
| A: CAS number of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline is 65538-43-4. |
| Q: What is the molecular formula of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline? |
| A: Molecular formula of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline is C17H19Br2N3. |
| Q: What is the Chinese name of 65538-43-4? |
| A: Chinese name of 65538-43-4 is 65538-43-4. |
| Q: What is the InChIKey of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline? |
| A: InChIKey of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline is GZKOFHDUGZXKEA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline? |
| A: Molecular weight of 4-[(2,4-dibromo-6-methylphenyl)diazenyl]-N,N-diethylaniline is 425.2. |