3-(1-cyclohepta-2,4,6-trienyl)pentane-2,4-dione structure
|
Common Name | 3-(1-cyclohepta-2,4,6-trienyl)pentane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 65548-56-3 | Molecular Weight | 190.23800 | |
| Density | 1.037g/cm3 | Boiling Point | 305.6ºC at 760 mmHg | |
| Molecular Formula | C12H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.2ºC | |
| Name | 3-cyclohepta-2,4,6-trien-1-ylpentane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.037g/cm3 |
|---|---|
| Boiling Point | 305.6ºC at 760 mmHg |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.23800 |
| Flash Point | 114.2ºC |
| Exact Mass | 190.09900 |
| PSA | 34.14000 |
| LogP | 2.07900 |
| Index of Refraction | 1.503 |
| InChIKey | YWNYRHVJXKBAJO-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(C)=O)C1C=CC=CC=C1 |
|
~%
3-(1-cyclohepta... CAS#:65548-56-3 |
| Literature: Komatsu,K. et al. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 3425 - 3426 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 7-Tropyl-acetylaceton |
| 3-cyclohepta-2,4,6-trienyl-pentane-2,4-dione |
| Tropylacetylaceton |
| 3-Cyclohepta-2,4,6-trienyl-pentan-2,4-dion |