Bis bispenol A dicarbonate
Modify Date: 2025-10-01 03:05:19
Bis bispenol A dicarbonate structure
|
Common Name | Bis bispenol A dicarbonate | ||
|---|---|---|---|---|
| CAS Number | 65559-16-2 | Molecular Weight | 736.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C47H44O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bis bispenol A dicarbonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C47H44O8 |
|---|---|
| Molecular Weight | 736.8 |
| InChIKey | ACSIRFUZUVLNBL-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(OC(=O)Oc2ccc(C(C)(C)c3ccc(OC(=O)Oc4ccc(C(C)(C)c5ccc(O)cc5)cc4)cc3)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Bis bispenol A dicarbonate? |
| A: InChIKey of Bis bispenol A dicarbonate is ACSIRFUZUVLNBL-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Bis bispenol A dicarbonate? |
| A: SMILES notation of Bis bispenol A dicarbonate is CC(C)(c1ccc(O)cc1)c1ccc(OC(=O)Oc2ccc(C(C)(C)c3ccc(OC(=O)Oc4ccc(C(C)(C)c5ccc(O)cc5)cc4)cc3)cc2)cc1. |
| Q: What is the molecular formula of Bis bispenol A dicarbonate? |
| A: Molecular formula of Bis bispenol A dicarbonate is C47H44O8. |
| Q: What is the Chinese name of 65559-16-2? |
| A: Chinese name of 65559-16-2 is 65559-16-2. |
| Q: What is the molecular weight of Bis bispenol A dicarbonate? |
| A: Molecular weight of Bis bispenol A dicarbonate is 736.8. |
| Q: What is the English name of Bis bispenol A dicarbonate? |
| A: The English name of Bis bispenol A dicarbonate is Bis bispenol A dicarbonate. |
| Q: What is the CAS number of Bis bispenol A dicarbonate? |
| A: CAS number of Bis bispenol A dicarbonate is 65559-16-2. |