1-(benzhydrylamino)ethyl-hydroxy-oxophosphanium structure
|
Common Name | 1-(benzhydrylamino)ethyl-hydroxy-oxophosphanium | ||
|---|---|---|---|---|
| CAS Number | 65577-30-2 | Molecular Weight | 274.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO2P+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(benzhydrylamino)ethyl-hydroxy-oxophosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17NO2P+ |
|---|---|
| Molecular Weight | 274.27500 |
| Exact Mass | 274.10000 |
| PSA | 84.89000 |
| LogP | 2.85830 |
| InChIKey | XWFFSRRXKCWBOV-UHFFFAOYSA-O |
| SMILES | CC(NC(c1ccccc1)c1ccccc1)[P+](=O)O |
|
~91%
1-(benzhydrylam... CAS#:65577-30-2 |
| Literature: Baylis, E. Keith; Campbell, Colin D.; Dingwall, John G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , p. 2845 - 2853 |
|
~%
1-(benzhydrylam... CAS#:65577-30-2 |
| Literature: Grobelny, Damian Synthesis, 1987 , # 10 p. 942 - 943 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(benzhydrylamino)ethylphosphinic acid |
| (1-benzhydrylamino-ethyl)-phosphonous acid |
| [1-[(diphenylmethyl)amino]ethyl]phosphinic acid |
| 6221P |