Ethyl p-nitrophenyl benzenethiophosphonate, (+)
Modify Date: 2026-08-22 16:46:33
Ethyl p-nitrophenyl benzenethiophosphonate, (+) structure
|
Common Name | Ethyl p-nitrophenyl benzenethiophosphonate, (+) | ||
|---|---|---|---|---|
| CAS Number | 65580-79-2 | Molecular Weight | 323.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14NO4PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl p-nitrophenyl benzenethiophosphonate, (+) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14NO4PS |
|---|---|
| Molecular Weight | 323.31 |
| InChIKey | AIGRXSNSLVJMEA-HXUWFJFHSA-N |
| SMILES | CCOP(=S)(Oc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Ethyl p-nitrophenyl benzenethiophosphonate, (+)? |
| A: Molecular weight of Ethyl p-nitrophenyl benzenethiophosphonate, (+) is 323.31. |
| Q: What is the Chinese name of 65580-79-2? |
| A: Chinese name of 65580-79-2 is 65580-79-2. |
| Q: What is the InChIKey of Ethyl p-nitrophenyl benzenethiophosphonate, (+)? |
| A: InChIKey of Ethyl p-nitrophenyl benzenethiophosphonate, (+) is AIGRXSNSLVJMEA-HXUWFJFHSA-N. |
| Q: What is the English name of Ethyl p-nitrophenyl benzenethiophosphonate, (+)? |
| A: The English name of Ethyl p-nitrophenyl benzenethiophosphonate, (+) is Ethyl p-nitrophenyl benzenethiophosphonate, (+). |
| Q: What is the molecular formula of Ethyl p-nitrophenyl benzenethiophosphonate, (+)? |
| A: Molecular formula of Ethyl p-nitrophenyl benzenethiophosphonate, (+) is C14H14NO4PS. |
| Q: What is the CAS number of Ethyl p-nitrophenyl benzenethiophosphonate, (+)? |
| A: CAS number of Ethyl p-nitrophenyl benzenethiophosphonate, (+) is 65580-79-2. |
| Q: What is the SMILES notation of Ethyl p-nitrophenyl benzenethiophosphonate, (+)? |
| A: SMILES notation of Ethyl p-nitrophenyl benzenethiophosphonate, (+) is CCOP(=S)(Oc1ccc([N+](=O)[O-])cc1)c1ccccc1. |