stearoxylic acid
stearoxylic acid structure
|
Common Name | stearoxylic acid | ||
|---|---|---|---|---|
| CAS Number | 656-73-5 | Molecular Weight | 312.44400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9,10-diketostearic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H32O4 |
|---|---|
| Molecular Weight | 312.44400 |
| Exact Mass | 312.23000 |
| PSA | 71.44000 |
| LogP | 4.69050 |
| InChIKey | UCJSYDRGZVWHJS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)C(=O)CCCCCCCC(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918300090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:123-99-9
CAS#:505-48-6
CAS#:112-05-0
CAS#:144850-33-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,10-dioxo-octadecanoic acid |
| Stearoxylsaeure |
| 9.10-Dioxo-octadecansaeure |
| 9,10-dioxostearic acid |
| λ,ι-Dioxo-stearinsaeure |
| 9,10-Dioxo-octadecansaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 9,10-diketostearic acid? |
| A: InChIKey of 9,10-diketostearic acid is UCJSYDRGZVWHJS-UHFFFAOYSA-N. |
| Q: What English synonyms does 9,10-diketostearic acid have? |
| A: English synonyms of 9,10-diketostearic acid: 9,10-dioxo-octadecanoic acid, Stearoxylsaeure, 9.10-Dioxo-octadecansaeure, 9,10-dioxostearic acid, λ,ι-Dioxo-stearinsaeure, 9,10-Dioxo-octadecansaeure. |
| Q: What is the English name of 9,10-diketostearic acid? |
| A: The English name of 9,10-diketostearic acid is 9,10-diketostearic acid. |
| Q: What is the SMILES notation of 9,10-diketostearic acid? |
| A: SMILES notation of 9,10-diketostearic acid is CCCCCCCCC(=O)C(=O)CCCCCCCC(=O)O. |
| Q: What is the molecular formula of 9,10-diketostearic acid? |
| A: Molecular formula of 9,10-diketostearic acid is C18H32O4. |
| Q: What is the molecular weight of 9,10-diketostearic acid? |
| A: Molecular weight of 9,10-diketostearic acid is 312.44400. |
| Q: What is the LogP of 9,10-diketostearic acid? |
| A: LogP of 9,10-diketostearic acid is 4.69050. |
| Q: What is the Chinese name of 656-73-5? |
| A: Chinese name of 656-73-5 is 656-73-5. |
| Q: What is the polar surface area (PSA) of 9,10-diketostearic acid? |
| A: Polar surface area (PSA) of 9,10-diketostearic acid is 71.44000. |
| Q: What are the downstream products of 9,10-diketostearic acid? |
| A: Related downstream products(CAS) of 9,10-diketostearic acid: 123-99-9;505-48-6;112-05-0;144850-33-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |