Formamide,N-[4-chloro-3-(trifluoromethyl)phenyl]
![Formamide,N-[4-chloro-3-(trifluoromethyl)phenyl] Structure](https://image.chemsrc.com/caspic/440/656-96-2.png)
Formamide,N-[4-chloro-3-(trifluoromethyl)phenyl] structure
|
Common Name | Formamide,N-[4-chloro-3-(trifluoromethyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 656-96-2 | Molecular Weight | 223.58000 | |
| Density | 1.474g/cm3 | Boiling Point | 320.8ºC at 760mmHg | |
| Molecular Formula | C8H5ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.474g/cm3 |
|---|---|
| Boiling Point | 320.8ºC at 760mmHg |
| Molecular Formula | C8H5ClF3NO |
| Molecular Weight | 223.58000 |
| Flash Point | 147.8ºC |
| Exact Mass | 223.00100 |
| PSA | 29.10000 |
| LogP | 3.63600 |
| Index of Refraction | 1.517 |
| InChIKey | JCGSMHPPPSDAKF-UHFFFAOYSA-N |
| SMILES | O=CNc1ccc(Cl)c(C(F)(F)F)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Chlor-3-trifluormethyl-carbanilsaeure-furfurylester |
| 4-Chlor-3-trifluormethyl-formanilid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride? |
| A: Molecular weight of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride is 223.58000. |
| Q: What is the polar surface area (PSA) of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride? |
| A: Polar surface area (PSA) of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride is 29.10000. |
| Q: What is the molecular formula of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride? |
| A: Molecular formula of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride is C8H5ClF3NO. |
| Q: What is the Chinese name of 656-96-2? |
| A: Chinese name of 656-96-2 is 656-96-2. |
| Q: What is the boiling point of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride? |
| A: Boiling point of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride is 320.8ºC at 760mmHg. |
| Q: What is the CAS number of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride? |
| A: CAS number of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride is 656-96-2. |
| Q: What is the English name of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride? |
| A: The English name of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride is 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride. |
| Q: What is the SMILES notation of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride? |
| A: SMILES notation of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride is O=CNc1ccc(Cl)c(C(F)(F)F)c1. |
| Q: What is the InChIKey of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride? |
| A: InChIKey of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride is JCGSMHPPPSDAKF-UHFFFAOYSA-N. |
| Q: What English synonyms does 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride have? |
| A: English synonyms of 2-(4,4-dithiophen-2-ylbut-3-en-2-yl)pyridine,hydrochloride: 4-Chlor-3-trifluormethyl-carbanilsaeure-furfurylester, 4-Chlor-3-trifluormethyl-formanilid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |