1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole
![1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole Structure](https://image.chemsrc.com/caspic/009/65601-07-2.png)
1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole structure
|
Common Name | 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole | ||
|---|---|---|---|---|
| CAS Number | 65601-07-2 | Molecular Weight | 198.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14N2 |
|---|---|
| Molecular Weight | 198.26400 |
| Exact Mass | 198.11600 |
| PSA | 28.15000 |
| LogP | 2.35870 |
| InChIKey | RHZNBRTZMBDFOB-UHFFFAOYSA-N |
| SMILES | CCC1=NCCc2c1[nH]c1ccccc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![1-ethyl-9H-pyrido[3,4-b]indole structure](https://image.chemsrc.com/caspic/120/20127-61-1.png)
CAS#:20127-61-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Aethyl-4,9-dihydro-3H-β-carbolin |
| 1-ethyl-3,4-dihydro-β-carboline |
| 1-Aethyl-2,3-dihydro-β-carbolin |
| 1-ethyl-3,4-dihydro-9H-β-carboline |
| 1-ethyl-4,9-dihydro-3H-β-carboline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole? |
| A: InChIKey of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole is RHZNBRTZMBDFOB-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 65601-07-2? |
| A: Chinese name of 65601-07-2 is 65601-07-2. |
| Q: What is the molecular formula of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole? |
| A: Molecular formula of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole is C13H14N2. |
| Q: What is the molecular weight of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole? |
| A: Molecular weight of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole is 198.26400. |
| Q: What is the English name of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole? |
| A: The English name of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole is 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole. |
| Q: What is the CAS number of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole? |
| A: CAS number of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole is 65601-07-2. |
| Q: What is the SMILES notation of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole? |
| A: SMILES notation of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole is CCC1=NCCc2c1[nH]c1ccccc21. |
| Q: What is the polar surface area (PSA) of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole? |
| A: Polar surface area (PSA) of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole is 28.15000. |
| Q: What are the downstream products of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole? |
| A: Related downstream products(CAS) of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole: 20127-61-1. |
| Q: What English synonyms does 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole have? |
| A: English synonyms of 1-Ethyl-4,9-dihydro-3H-pyrido[3,4-b]indole: 1-Aethyl-4,9-dihydro-3H-β-carbolin, 1-ethyl-3,4-dihydro-β-carboline, 1-Aethyl-2,3-dihydro-β-carbolin, 1-ethyl-3,4-dihydro-9H-β-carboline, 1-ethyl-4,9-dihydro-3H-β-carboline. |