benzothiazole-2(3H)-thione, compound with triethylamine (1:1) structure
|
Common Name | benzothiazole-2(3H)-thione, compound with triethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 65605-48-3 | Molecular Weight | 268.44100 | |
| Density | N/A | Boiling Point | 305ºC at 760 mmHg | |
| Molecular Formula | C13H20N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.3ºC | |
| Name | 3H-1,3-benzothiazole-2-thione,N,N-diethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 305ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.44100 |
| Flash Point | 138.3ºC |
| Exact Mass | 268.10700 |
| PSA | 83.17000 |
| LogP | 3.93310 |
| InChIKey | DVUKIEBZAXCCAA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.S=c1[nH]c2ccccc2s1 |
| EINECS 265-843-0 |
| Triethylammonium 2-mercaptobenzothiazole |
| 2(3H)-Benzothiazolethione,compd. with N,N-diethylethanamine (1:1) |
| Benzothiazole-2(3H)-thione,compound with triethylamine (1:1) |