4-(Benzyloxy)-3-hydroxybenzyl Alcohol 3-p-Toluenesulfonate structure
|
Common Name | 4-(Benzyloxy)-3-hydroxybenzyl Alcohol 3-p-Toluenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 65615-21-6 | Molecular Weight | 384.44600 | |
| Density | 1.291g/cm3 | Boiling Point | 589.621ºC at 760 mmHg | |
| Molecular Formula | C21H20O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.392ºC | |
| Name | [5-(hydroxymethyl)-2-phenylmethoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 589.621ºC at 760 mmHg |
| Molecular Formula | C21H20O5S |
| Molecular Weight | 384.44600 |
| Flash Point | 310.392ºC |
| Exact Mass | 384.10300 |
| PSA | 81.21000 |
| LogP | 4.91480 |
| Index of Refraction | 1.614 |
| InChIKey | ORXTZEFXNKCLPS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(CO)ccc2OCc2ccccc2)cc1 |
| HS Code | 2909499000 |
|---|
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 4-Benzyloxy-3-tosyloxy-benzylalkohol |
| 4-(Benzyloxy)-3-hydroxybenzyl Alcohol 3-p-Toluenesulfonate |
| 3-[[(4-Methylphenyl)sulfonyl]oxy]-4-(phenylmethoxy)benzenemethanol |