1-(4-Methylphenyl)-4-oxocyclohexanecarbonitrile structure
|
Common Name | 1-(4-Methylphenyl)-4-oxocyclohexanecarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 65619-01-4 | Molecular Weight | 213.275 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 393.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9±27.9 °C | |
| Name | 1-(4-methylphenyl)-4-oxocyclohexane-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 393.6±42.0 °C at 760 mmHg |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.275 |
| Flash Point | 191.9±27.9 °C |
| Exact Mass | 213.115356 |
| PSA | 40.86000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | RYTSBLXGZFFBOQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2(C#N)CCC(=O)CC2)cc1 |
| HS Code | 2926909090 |
|---|
|
~76%
1-(4-Methylphen... CAS#:65619-01-4 |
| Literature: The Upjohn Company Patent: US4065573 A1, 1977 ; |
|
~72%
1-(4-Methylphen... CAS#:65619-01-4 |
| Literature: Lednicer, Daniel; VonVoigtlander, Philip F.; Emmert, D. Edward Journal of Medicinal Chemistry, 1980 , vol. 23, # 4 p. 424 - 430 |
|
~%
1-(4-Methylphen... CAS#:65619-01-4 |
| Literature: Upjohn Patent: DE2723937 , 1977 ; Chem.Abstr., 1978 , vol. 88, # 104776 |
|
~%
1-(4-Methylphen... CAS#:65619-01-4 |
| Literature: Upjohn Patent: DE2723937 , 1977 ; Chem.Abstr., 1978 , vol. 88, # 104776 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(4-Methylphenyl)-4-oxocyclohexanecarbonitrile |
| 4-cyano-4-(p-tolyl)cyclohexanone |
| 4-CYANO-4-(4-METHYLPHENYL)CYCLOHEXANONE |
| Cyclohexanecarbonitrile, 1-(4-methylphenyl)-4-oxo- |
| 4-Cyano-4-(p-tolyl)-cyclohexanon |
| 4-oxo-1-p-tolylcyclohexanecarbonitrile |