Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate
Modify Date: 2026-09-29 00:32:30
Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate structure
|
Common Name | Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate | ||
|---|---|---|---|---|
| CAS Number | 65619-22-9 | Molecular Weight | 358.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17Cl2NO4 |
|---|---|
| Molecular Weight | 358.2 |
| InChIKey | HVVAWWNFPCQEDD-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(C#N)(CCC(=O)OC)c1ccc(Cl)c(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate? |
| A: SMILES notation of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate is COC(=O)CCC(C#N)(CCC(=O)OC)c1ccc(Cl)c(Cl)c1. |
| Q: What is the InChIKey of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate? |
| A: InChIKey of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate is HVVAWWNFPCQEDD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 65619-22-9? |
| A: Chinese name of 65619-22-9 is 65619-22-9. |
| Q: What is the English name of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate? |
| A: The English name of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate is Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate. |
| Q: What is the CAS number of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate? |
| A: CAS number of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate is 65619-22-9. |
| Q: What is the molecular formula of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate? |
| A: Molecular formula of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate is C16H17Cl2NO4. |
| Q: What is the molecular weight of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate? |
| A: Molecular weight of Dimethyl 4-cyano-4-(3,4-dichlorophenyl)heptanedioate is 358.2. |