1,3-bis(4-fluorophenyl)propan-2-one
1,3-bis(4-fluorophenyl)propan-2-one structure
|
Common Name | 1,3-bis(4-fluorophenyl)propan-2-one | ||
|---|---|---|---|---|
| CAS Number | 65622-33-5 | Molecular Weight | 246.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-bis(4-fluorophenyl)propan-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H12F2O |
|---|---|
| Molecular Weight | 246.25200 |
| Exact Mass | 246.08600 |
| PSA | 17.07000 |
| LogP | 3.31910 |
| InChIKey | BPARIXKHXBXFHU-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc(F)cc1)Cc1ccc(F)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~80%
1,3-bis(4-fluor... CAS#:65622-33-5 |
| Literature: Yang; Hay Synthesis, 1992 , # 5 p. 467 - 472 |
|
~97%
1,3-bis(4-fluor... CAS#:65622-33-5 |
| Literature: Kowa Company, Ltd. Patent: EP2143714 A1, 2010 ; Location in patent: Page/Page column 103-104 ; |
|
~79%
1,3-bis(4-fluor... CAS#:65622-33-5 |
| Literature: Matsumoto, Kiyoshi; Okada, Akihiro; Girek, Tomasz; Ikemi, Yukio; Kim, Jong Chul; Hayashi, Naoto; Yoshida, Hiroshi; Kakehi, Akikazu Heterocyclic Communications, 2002 , vol. 8, # 4 p. 325 - 328 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:142272-54-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-bis(p-fluorophenyl)propanone-2 |
| 1,3-bis(4-fluorophenyl)-2-propanone |
| 2-Propanone,1,3-bis(4-fluorophenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,3-bis(4-fluorophenyl)propan-2-one? |
| A: Molecular formula of 1,3-bis(4-fluorophenyl)propan-2-one is C15H12F2O. |
| Q: What is the CAS number of 1,3-bis(4-fluorophenyl)propan-2-one? |
| A: CAS number of 1,3-bis(4-fluorophenyl)propan-2-one is 65622-33-5. |
| Q: What is the LogP of 1,3-bis(4-fluorophenyl)propan-2-one? |
| A: LogP of 1,3-bis(4-fluorophenyl)propan-2-one is 3.31910. |
| Q: What is the InChIKey of 1,3-bis(4-fluorophenyl)propan-2-one? |
| A: InChIKey of 1,3-bis(4-fluorophenyl)propan-2-one is BPARIXKHXBXFHU-UHFFFAOYSA-N. |
| Q: What is the English name of 1,3-bis(4-fluorophenyl)propan-2-one? |
| A: The English name of 1,3-bis(4-fluorophenyl)propan-2-one is 1,3-bis(4-fluorophenyl)propan-2-one. |
| Q: What is the Chinese name of 65622-33-5? |
| A: Chinese name of 65622-33-5 is 65622-33-5. |
| Q: What is the molecular weight of 1,3-bis(4-fluorophenyl)propan-2-one? |
| A: Molecular weight of 1,3-bis(4-fluorophenyl)propan-2-one is 246.25200. |
| Q: What are the upstream materials of 1,3-bis(4-fluorophenyl)propan-2-one? |
| A: Related upstream materials(CAS) of 1,3-bis(4-fluorophenyl)propan-2-one: 405-50-5;587-88-2;459-46-1. |
| Q: What is the SMILES notation of 1,3-bis(4-fluorophenyl)propan-2-one? |
| A: SMILES notation of 1,3-bis(4-fluorophenyl)propan-2-one is O=C(Cc1ccc(F)cc1)Cc1ccc(F)cc1. |
| Q: What are the downstream products of 1,3-bis(4-fluorophenyl)propan-2-one? |
| A: Related downstream products(CAS) of 1,3-bis(4-fluorophenyl)propan-2-one: 142272-54-6. |